CAS 42498-39-5 is the registry number for N-t-Butyl 3-bromobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N-tert-butylbenzamide (CAS 42498-39-5) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 3-bromo-N-tert-butylbenzamide. InChIKey: RCANCXBUPLNOOD-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 3-bromo-N-tert-butylbenzamide |
| InChIKey | RCANCXBUPLNOOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)