CAS 42498-40-8 appears in our catalog under these names: N-tert-Butyl 4-chlorobenzamide, 98%, N-(tert-Butyl)-4-chlorobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
N-tert-butyl-4-chlorobenzamide (CAS 42498-40-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: N-tert-butyl-4-chlorobenzamide. InChIKey: XOEWMCMXPCWIDY-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | N-tert-butyl-4-chlorobenzamide |
| InChIKey | XOEWMCMXPCWIDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)