CAS 42517-23-7 is the registry number for 2-Isopropyl-benzothiazol-6-ylamine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-propan-2-yl-1,3-benzothiazol-6-amine (CAS 42517-23-7) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: 2-propan-2-yl-1,3-benzothiazol-6-amine. InChIKey: HWXYBXYFYWOVAS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 2-propan-2-yl-1,3-benzothiazol-6-amine |
| InChIKey | HWXYBXYFYWOVAS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(S1)C=C(C=C2)N |
Computed by PubChem (NCBI)