Products 425370-70-3
CAS 425370-70-3 is the registry number for 2H-1-Benzopyran-2-one, 6-[(1R,2S)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-7-methoxy-. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(1R,2S)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-7-methoxychromen-2-one (CAS 425370-70-3) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. IUPAC name: 6-[(1R,2S)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-7-methoxychromen-2-one. InChIKey: GIRZZQJILPTTEK-CABCVRRESA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 6-[(1R,2S)-2,3-dihydroxy-1-methoxy-3-methylbutyl]-7-methoxychromen-2-one |
| InChIKey | GIRZZQJILPTTEK-CABCVRRESA-N |
| SMILES | CC(C)([C@H]([C@@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)OC)O)O |
Computed by PubChem (NCBI)