Products 425373-64-4

CAS 425373-64-4 is the registry number for 3-(2-Bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

3-(2-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole (CAS 425373-64-4) is a chemical compound with the molecular formula C14H8BrClN2O and a molecular weight of 335.58 g/mol. IUPAC name: 3-(2-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole. InChIKey: UZPFCJFMWDPDJT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8BrClN2O
Molecular weight335.58 g/mol
IUPAC name3-(2-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole
InChIKeyUZPFCJFMWDPDJT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NOC(=N2)C3=CC=C(C=C3)Cl)Br

Computed by PubChem (NCBI)