CAS 489435-05-4 is the registry number for 3-(4-Bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole (CAS 489435-05-4) is a chemical compound with the molecular formula C14H8BrClN2O and a molecular weight of 335.58 g/mol. IUPAC name: 3-(4-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole. InChIKey: CAOVZBCCDYEKCE-UHFFFAOYSA-N.
| Molecular formula | C14H8BrClN2O |
|---|---|
| Molecular weight | 335.58 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-(4-chlorophenyl)-1,2,4-oxadiazole |
| InChIKey | CAOVZBCCDYEKCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NO2)C3=CC=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)