Products 425379-95-9
CAS 425379-95-9 is the registry number for 1-(5-bromo-2-fluorophenyl)-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(5-bromo-2-fluorophenyl)pyrazole (CAS 425379-95-9) is a chemical compound with the molecular formula C9H6BrFN2 and a molecular weight of 241.06 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)pyrazole. InChIKey: LFARAYXKOYUULQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2 |
|---|---|
| Molecular weight | 241.06 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)pyrazole |
| InChIKey | LFARAYXKOYUULQ-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)