Products 4254-17-5
CAS 4254-17-5 appears in our catalog under these names: 4-Methoxybenzoin, 98%, 2-Hydroxy-1-(4-methoxyphenyl)-2-phenylethanone, 98%, 4-Methoxybenzoin. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 50g.
2-hydroxy-1-(4-methoxyphenyl)-2-phenylethanone (CAS 4254-17-5) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-hydroxy-1-(4-methoxyphenyl)-2-phenylethanone. InChIKey: PVSFIFPJPUEHPO-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-hydroxy-1-(4-methoxyphenyl)-2-phenylethanone |
| InChIKey | PVSFIFPJPUEHPO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)