CAS 425664-58-0 is the registry number for 1-(3,4-dichlorophenyl)-3-(4-methylbenzoyl)thiourea. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(3,4-dichlorophenyl)carbamothioyl]-4-methylbenzamide (CAS 425664-58-0) is a chemical compound with the molecular formula C15H12Cl2N2OS and a molecular weight of 339.2 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)carbamothioyl]-4-methylbenzamide. InChIKey: DMGQTIGGCUFODT-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2OS |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)carbamothioyl]-4-methylbenzamide |
| InChIKey | DMGQTIGGCUFODT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC(=S)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)