CAS 4274-38-8 appears in our catalog under these names: 2-Amino-4-(trifluoromethyl)benzenethiol Hydrochloride, >95% (HPLC), 2–Amino–4–(trifluoromethyl)benzenethiol hydrochloride, 2-Amino-4-(trifluoromethyl)thiophenol hydrochloride, 97% , 2-Amino-4-(trifluoromethyl)benzenethiol hydrochloride 95%, 2-AMINO-4-(TRIFLUOROMETHYL)BENZENETHIOL&. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100g.
2-amino-4-(trifluoromethyl)benzenethiol;hydrochloride (CAS 4274-38-8) is a chemical compound with the molecular formula C7H7ClF3NS and a molecular weight of 229.65 g/mol. IUPAC name: 2-amino-4-(trifluoromethyl)benzenethiol;hydrochloride. InChIKey: FIAGYDIJZOWVAB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3NS |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethyl)benzenethiol;hydrochloride |
| InChIKey | FIAGYDIJZOWVAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)S.Cl |
Computed by PubChem (NCBI)