CAS 96232-04-1 appears in our catalog under these names: 2-Amino-5-(trifluoromethyl)benzene-1-thiol hydrochloride, 95%, 2-amino-5-(trifluoromethyl)benzene-1-thiol hydrochloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-amino-5-(trifluoromethyl)benzenethiol;hydrochloride (CAS 96232-04-1) is a chemical compound with the molecular formula C7H7ClF3NS and a molecular weight of 229.65 g/mol. IUPAC name: 2-amino-5-(trifluoromethyl)benzenethiol;hydrochloride. InChIKey: REIQQFZDOIRQRJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF3NS |
|---|---|
| Molecular weight | 229.65 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethyl)benzenethiol;hydrochloride |
| InChIKey | REIQQFZDOIRQRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S)N.Cl |
Computed by PubChem (NCBI)