CAS 427883-74-7 is the registry number for 2,7-Dibromo-10-ethylacridin-9(10H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,7-dibromo-10-ethylacridin-9-one (CAS 427883-74-7) is a chemical compound with the molecular formula C15H11Br2NO and a molecular weight of 381.06 g/mol. IUPAC name: 2,7-dibromo-10-ethylacridin-9-one. InChIKey: JORUWNQWPBBNKI-UHFFFAOYSA-N.
| Molecular formula | C15H11Br2NO |
|---|---|
| Molecular weight | 381.06 g/mol |
| IUPAC name | 2,7-dibromo-10-ethylacridin-9-one |
| InChIKey | JORUWNQWPBBNKI-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)C(=O)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)