CAS 42793-13-5 appears in our catalog under these names: 9(R)–δ7–THC, 9(R)–δ7–THC (CRM). Offered by: GLPBio. Available pack sizes: 5mg, 1mg.
(6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,9,10,10a-tetrahydrobenzo[c]chromen-1-ol (CAS 42793-13-5) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,9,10,10a-tetrahydrobenzo[c]chromen-1-ol. InChIKey: WWYMYGIVLCKTBL-USXIJHARSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (6aR,9R,10aR)-6,6,9-trimethyl-3-pentyl-6a,9,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | WWYMYGIVLCKTBL-USXIJHARSA-N |
| SMILES | CCCCCC1=CC(=C2[C@@H]3C[C@H](C=C[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)