CAS 428502-54-9 is the registry number for 2-furyl 4-((2-nitrophenyl)sulfonyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
Furan-2-yl-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone (CAS 428502-54-9) is a chemical compound with the molecular formula C15H15N3O6S and a molecular weight of 365.4 g/mol. IUPAC name: furan-2-yl-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone. InChIKey: BMSMDSMCIKEEQB-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O6S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | furan-2-yl-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| InChIKey | BMSMDSMCIKEEQB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=CO2)S(=O)(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)