Products 871014-06-1
CAS 871014-06-1 is the registry number for N-(2-Methoxyphenyl)-2-(2-nitrophenylsulfonamido)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
N-(2-methoxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide (CAS 871014-06-1) is a chemical compound with the molecular formula C15H15N3O6S and a molecular weight of 365.4 g/mol. IUPAC name: N-(2-methoxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide. InChIKey: VZVWCHYOMQTMGS-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O6S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | N-(2-methoxyphenyl)-2-[(2-nitrophenyl)sulfonylamino]acetamide |
| InChIKey | VZVWCHYOMQTMGS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC(=O)CNS(=O)(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)