CAS 428843-08-7 is the registry number for 3-((2-Chloro-6-ethoxy-4-formylphenoxy)methyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]benzoic acid (CAS 428843-08-7) is a chemical compound with the molecular formula C17H15ClO5 and a molecular weight of 334.7 g/mol. IUPAC name: 3-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]benzoic acid. InChIKey: OITIIZACYUXYBV-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO5 |
|---|---|
| Molecular weight | 334.7 g/mol |
| IUPAC name | 3-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]benzoic acid |
| InChIKey | OITIIZACYUXYBV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Cl)OCC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)