Products 585533-78-4
CAS 585533-78-4 is the registry number for Chloroquinocin. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-9,10-dihydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,7-dione (CAS 585533-78-4) is a chemical compound with the molecular formula C17H15ClO5 and a molecular weight of 334.7 g/mol. IUPAC name: 8-chloro-9,10-dihydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,7-dione. InChIKey: UKNCHDWLJGPOIT-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO5 |
|---|---|
| Molecular weight | 334.7 g/mol |
| IUPAC name | 8-chloro-9,10-dihydroxy-3-methyl-1-propyl-1H-benzo[g]isochromene-6,7-dione |
| InChIKey | UKNCHDWLJGPOIT-UHFFFAOYSA-N |
| SMILES | CCCC1C2=C(C3=C(C=C2C=C(O1)C)C(=O)C(=O)C(=C3O)Cl)O |
Computed by PubChem (NCBI)