CAS 428871-06-1 appears in our catalog under these names: 2,2-Dimethyloxan-4-yl methanesulfonate, 95%, 2,2-Dimethyloxan-4-yl methanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,2-dimethyloxan-4-yl) methanesulfonate (CAS 428871-06-1) is a chemical compound with the molecular formula C8H16O4S and a molecular weight of 208.28 g/mol. IUPAC name: (2,2-dimethyloxan-4-yl) methanesulfonate. InChIKey: SKTGZWGUTJDDBC-UHFFFAOYSA-N.
| Molecular formula | C8H16O4S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | (2,2-dimethyloxan-4-yl) methanesulfonate |
| InChIKey | SKTGZWGUTJDDBC-UHFFFAOYSA-N |
| SMILES | CC1(CC(CCO1)OS(=O)(=O)C)C |
Computed by PubChem (NCBI)