CAS 42935-32-0 is the registry number for 3,5-Diiodosalicylic acid lithium salt. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
Lithium 2-hydroxy-3,5-diiodobenzoate (CAS 42935-32-0) is a chemical compound with the molecular formula C7H3I2LiO3 and a molecular weight of 395.9 g/mol. IUPAC name: lithium 2-hydroxy-3,5-diiodobenzoate. InChIKey: HLBRJWWTLIAOTE-UHFFFAOYSA-M.
| Molecular formula | C7H3I2LiO3 |
|---|---|
| Molecular weight | 395.9 g/mol |
| IUPAC name | lithium 2-hydroxy-3,5-diiodobenzoate |
| InChIKey | HLBRJWWTLIAOTE-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(C=C(C(=C1C(=O)[O-])O)I)I |
Computed by PubChem (NCBI)