CAS 4295-92-5 appears in our catalog under these names: Cis-3,5-dimethyldihydro-2h-pyran-2,6(3h)-dione, 95%, cis-3,5-Dimethyldihydro-2H-pyran-2,6(3H)-dione, 95+%, cis-3,5-Dimethyldihydro-2H-pyran-2,6(3H)-dione, ≥95%, ≥95%, (3R,5S)-3,5-dimethyldihydro-2H-pyran-2,6(3H)-dione, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 25g.
(3R,5S)-3,5-dimethyloxane-2,6-dione (CAS 4295-92-5) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (3R,5S)-3,5-dimethyloxane-2,6-dione. InChIKey: SIFQWEJOHACJOL-SYDPRGILSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (3R,5S)-3,5-dimethyloxane-2,6-dione |
| InChIKey | SIFQWEJOHACJOL-SYDPRGILSA-N |
| SMILES | C[C@@H]1C[C@@H](C(=O)OC1=O)C |
Computed by PubChem (NCBI)