CAS 4298-15-1 appears in our catalog under these names: Desethyl Hydroxychloroquine, Hydroxychloroquine Sulfate EP Impurity C (Desethyl Hydroxy Chloroquine), Hydroxychloroquine Sulfate EP Impurity C, Cletoquine, >95% (HPLC), Cletoquine/ 97.26% (existing batch purity). Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, on request, 10mg, 5mg, 25mg, 50mg, 2mg, 100mg.
2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol (CAS 4298-15-1) is a chemical compound with the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol. InChIKey: XFICNUNWUREFDP-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN3O |
|---|---|
| Molecular weight | 307.82 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol |
| InChIKey | XFICNUNWUREFDP-UHFFFAOYSA-N |
| SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl |
Computed by PubChem (NCBI)