CAS 97821-63-1 is the registry number for 1-(4-Chloro-phenyl)-4,4-dimethyl-3-(1,3,4-triazol-1-yl-methyl)-pentan-3-ol, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-4-ylmethyl)pentan-3-ol (CAS 97821-63-1) is a chemical compound with the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. IUPAC name: 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-4-ylmethyl)pentan-3-ol. InChIKey: DIQITXGMOQMLSS-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN3O |
|---|---|
| Molecular weight | 307.82 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-4-ylmethyl)pentan-3-ol |
| InChIKey | DIQITXGMOQMLSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CCC1=CC=C(C=C1)Cl)(CN2C=NN=C2)O |
Computed by PubChem (NCBI)