CAS 43019-90-5 appears in our catalog under these names: Benzoyl-d5 Chloride, >95% (GC), Benzoyl-d5 Chloride, 99 atom % D, min 98% Chemical Purity, BENZOYL-D5 CHLORIDE, 99 ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 5g.
2,3,4,5,6-pentadeuteriobenzoyl chloride (CAS 43019-90-5) is a chemical compound with the molecular formula C7H5ClO and a molecular weight of 145.60 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriobenzoyl chloride. InChIKey: PASDCCFISLVPSO-RALIUCGRSA-N.
| Molecular formula | C7H5ClO |
|---|---|
| Molecular weight | 145.60 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriobenzoyl chloride |
| InChIKey | PASDCCFISLVPSO-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)Cl)[2H])[2H] |
Computed by PubChem (NCBI)