CAS 62285-59-0 appears in our catalog under these names: 4-Chlorobenzaldehyde-2,3,5,6-d4, >95% (HPLC), 4-Chlorobenzaldehyde-2,3,5,6-d4, 98 atom % D, min 96% Chemical Purity, 4-Chlorobenzaldehyde-2,3,5,6-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 100 mg, 10 mg.
4-chloro-2,3,5,6-tetradeuteriobenzaldehyde (CAS 62285-59-0) is a chemical compound with the molecular formula C7H5ClO and a molecular weight of 144.59 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuteriobenzaldehyde. InChIKey: AVPYQKSLYISFPO-RHQRLBAQSA-N.
| Molecular formula | C7H5ClO |
|---|---|
| Molecular weight | 144.59 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuteriobenzaldehyde |
| InChIKey | AVPYQKSLYISFPO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)