Products 4303-49-5
CAS 4303-49-5 appears in our catalog under these names: Diethyl malonate-d2, 95%, Diethyl Malonate-d2, >95% (GC), Diethyl Malonate-d2, 98 atom % D, min 98% Chemical Purity, Diethyl malonate–d2, DIETHYL MALONATE-D2, 98 ATOM % D. Offered by: Combi-blocks, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 1g.
Diethyl 2,2-dideuteriopropanedioate (CAS 4303-49-5) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 162.18 g/mol. IUPAC name: diethyl 2,2-dideuteriopropanedioate. InChIKey: IYXGSMUGOJNHAZ-BFWBPSQCSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | diethyl 2,2-dideuteriopropanedioate |
| InChIKey | IYXGSMUGOJNHAZ-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)