CAS 77386-82-4 appears in our catalog under these names: Diethyl Malonate-13C2, DIETHYL MALONATE-1,3-13C2, 99 ATOM % 13C. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 250MG.
Diethyl (1,3-13C2)propanedioate (CAS 77386-82-4) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 162.15 g/mol. IUPAC name: diethyl (1,3-13C2)propanedioate. InChIKey: IYXGSMUGOJNHAZ-AKZCFXPHSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | diethyl (1,3-13C2)propanedioate |
| InChIKey | IYXGSMUGOJNHAZ-AKZCFXPHSA-N |
| SMILES | CCO[13C](=O)C[13C](=O)OCC |
Computed by PubChem (NCBI)