CAS 43034-86-2 appears in our catalog under these names: N1-(3-(Trifluoromethyl)phenyl)benzene-1,2-diamine, 90%, N1-(3-(Trifluoromethyl)phenyl)benzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-N-[3-(trifluoromethyl)phenyl]benzene-1,2-diamine (CAS 43034-86-2) is a chemical compound with the molecular formula C13H11F3N2 and a molecular weight of 252.23 g/mol. IUPAC name: 2-N-[3-(trifluoromethyl)phenyl]benzene-1,2-diamine. InChIKey: AWUGJXBGADQEFJ-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 2-N-[3-(trifluoromethyl)phenyl]benzene-1,2-diamine |
| InChIKey | AWUGJXBGADQEFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)