CAS 886501-07-1 is the registry number for N-Benzyl-3-(trifluoromethyl)pyridin-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
N-benzyl-3-(trifluoromethyl)pyridin-2-amine (CAS 886501-07-1) is a chemical compound with the molecular formula C13H11F3N2 and a molecular weight of 252.23 g/mol. IUPAC name: N-benzyl-3-(trifluoromethyl)pyridin-2-amine. InChIKey: RLRVEPHRPXGPSA-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | N-benzyl-3-(trifluoromethyl)pyridin-2-amine |
| InChIKey | RLRVEPHRPXGPSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CC=N2)C(F)(F)F |
Computed by PubChem (NCBI)