CAS 431057-61-3 is the registry number for N-Isopropyl-2-(mesityloxy)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-propan-2-yl-2-(2,4,6-trimethylphenoxy)acetamide (CAS 431057-61-3) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: N-propan-2-yl-2-(2,4,6-trimethylphenoxy)acetamide. InChIKey: QWDDYWAXIVRATI-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | N-propan-2-yl-2-(2,4,6-trimethylphenoxy)acetamide |
| InChIKey | QWDDYWAXIVRATI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)OCC(=O)NC(C)C)C |
Computed by PubChem (NCBI)