CAS 43148-65-8 appears in our catalog under these names: (1R,2R)-Rel-n1,n1,n2,n2-tetramethylcyclohexane-1,2-diamine, 95%, (1R,2R)-rel-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine 98+%, rel-((1R,2R)-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine), 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100g.
Trans-(1R,2R)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine (CAS 43148-65-8) is a chemical compound with the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. IUPAC name: trans-(1R,2R)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine. InChIKey: DVDGHRQOLYEZAE-NXEZZACHSA-N.
| Molecular formula | C10H22N2 |
|---|---|
| Molecular weight | 170.30 g/mol |
| IUPAC name | trans-(1R,2R)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine |
| InChIKey | DVDGHRQOLYEZAE-NXEZZACHSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C)C |
Computed by PubChem (NCBI)