CAS 53152-68-4 appears in our catalog under these names: (1S,2S)-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine, 97%, (1S,2S)-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine 97%, (1S,2S)-N,N,N',N'-Tetramethylcyclohexane-1,2-diamine, 95%, 95%, (1S,2S)-N1,N1,N2,N2-Tetramethylcyclohexane-1,2-diamine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g.
Trans-(1S,2S)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine (CAS 53152-68-4) is a chemical compound with the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. IUPAC name: trans-(1S,2S)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine. InChIKey: DVDGHRQOLYEZAE-UWVGGRQHSA-N.
| Molecular formula | C10H22N2 |
|---|---|
| Molecular weight | 170.30 g/mol |
| IUPAC name | trans-(1S,2S)-1-N,1-N,2-N,2-N-tetramethylcyclohexane-1,2-diamine |
| InChIKey | DVDGHRQOLYEZAE-UWVGGRQHSA-N |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1N(C)C |
Computed by PubChem (NCBI)