CAS 4316-94-3 appears in our catalog under these names: 6-Chloro-5-nitropyrimidin-4-amine, 98%, 6-Chloro-5-nitropyrimidin-4-amine 95%, 6-Chloro-5-nitropyrimidin-4-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg, 10g.
6-chloro-5-nitropyrimidin-4-amine (CAS 4316-94-3) is a chemical compound with the molecular formula C4H3ClN4O2 and a molecular weight of 174.54 g/mol. IUPAC name: 6-chloro-5-nitropyrimidin-4-amine. InChIKey: BWLOHIMQWHFSQF-UHFFFAOYSA-N.
| Molecular formula | C4H3ClN4O2 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 6-chloro-5-nitropyrimidin-4-amine |
| InChIKey | BWLOHIMQWHFSQF-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)