CAS 618397-67-4 is the registry number for 2-Chloro-4-nitro-5-pyrimidinamine. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-chloro-4-nitropyrimidin-5-amine (CAS 618397-67-4) is a chemical compound with the molecular formula C4H3ClN4O2 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-4-nitropyrimidin-5-amine. InChIKey: SZAINBUPDLJWCN-UHFFFAOYSA-N.
| Molecular formula | C4H3ClN4O2 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 2-chloro-4-nitropyrimidin-5-amine |
| InChIKey | SZAINBUPDLJWCN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)