Products 618397-67-4

CAS 618397-67-4 is the registry number for 2-Chloro-4-nitro-5-pyrimidinamine. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-chloro-4-nitropyrimidin-5-amine (CAS 618397-67-4) is a chemical compound with the molecular formula C4H3ClN4O2 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-4-nitropyrimidin-5-amine. InChIKey: SZAINBUPDLJWCN-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3ClN4O2
Molecular weight174.54 g/mol
IUPAC name2-chloro-4-nitropyrimidin-5-amine
InChIKeySZAINBUPDLJWCN-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=N1)Cl)[N+](=O)[O-])N

Computed by PubChem (NCBI)