CAS 43179-48-2 appears in our catalog under these names: L-Arabinose diethyldithioacetal, 95%, L-Arabinose diethyldithioacetal. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 2000mg, 1000mg, 5000mg.
(2S,3S,4R)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol (CAS 43179-48-2) is a chemical compound with the molecular formula C9H20O4S2 and a molecular weight of 256.4 g/mol. IUPAC name: (2S,3S,4R)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol. InChIKey: IZQLWYVNJTUXNP-BIIVOSGPSA-N.
| Molecular formula | C9H20O4S2 |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | (2S,3S,4R)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol |
| InChIKey | IZQLWYVNJTUXNP-BIIVOSGPSA-N |
| SMILES | CCSC([C@@H]([C@H]([C@H](CO)O)O)O)SCC |
Computed by PubChem (NCBI)