CAS 6838-08-0 is the registry number for (2R,3S,4S)-5,5-Bis(ethylthio)pentane-1,2,3,4-tetraol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol (CAS 6838-08-0) is a chemical compound with the molecular formula C9H20O4S2 and a molecular weight of 256.4 g/mol. IUPAC name: (2R,3S,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol. InChIKey: IZQLWYVNJTUXNP-CSMHCCOUSA-N.
| Molecular formula | C9H20O4S2 |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | (2R,3S,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol |
| InChIKey | IZQLWYVNJTUXNP-CSMHCCOUSA-N |
| SMILES | CCSC([C@H]([C@H]([C@@H](CO)O)O)O)SCC |
Computed by PubChem (NCBI)