CAS 4318-05-2 is the registry number for N-Acetyl-2'-deoxyguanosine 3',5'-Diacetate. Offered by: TRC. Available pack sizes: 2,5g.
[(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-acetyloxyoxolan-2-yl]methyl acetate (CAS 4318-05-2) is a chemical compound with the molecular formula C16H19N5O7 and a molecular weight of 393.35 g/mol. IUPAC name: [(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-acetyloxyoxolan-2-yl]methyl acetate. InChIKey: RCOVGEMUNRNWBU-QJPTWQEYSA-N.
| Molecular formula | C16H19N5O7 |
|---|---|
| Molecular weight | 393.35 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-acetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | RCOVGEMUNRNWBU-QJPTWQEYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C(=O)N1)N=CN2[C@H]3C[C@@H]([C@H](O3)COC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)