CAS 953089-09-3 appears in our catalog under these names: Triacetyl Adenosine, 2,3,5-Tri-O-acetyl α-Adenosine, >95% (HPLC), 2,3,5-Tri-O-acetyl α-adenosine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 25mg, 50mg.
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate (CAS 953089-09-3) is a chemical compound with the molecular formula C16H19N5O7 and a molecular weight of 393.35 g/mol. IUPAC name: [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: GCVZNVTXNUTBFB-VSBTWAGUSA-N.
| Molecular formula | C16H19N5O7 |
|---|---|
| Molecular weight | 393.35 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | GCVZNVTXNUTBFB-VSBTWAGUSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@H](O1)N2C=NC3=C(N=CN=C32)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)