CAS 43189-39-5 is the registry number for H–Phg(4–OH)–Oet. Offered by: GLPBio. Available pack sizes: 100g, 25g.
Ethyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate (CAS 43189-39-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: ethyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate. InChIKey: CVWJDUUVFSVART-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | ethyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate |
| InChIKey | CVWJDUUVFSVART-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@H](C1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)