CAS 4319-19-1 is the registry number for N-ethyl-3-nitroaniline. Offered by: Chemat Brand. Available pack sizes: on request.
N-ethyl-3-nitroaniline (CAS 4319-19-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: N-ethyl-3-nitroaniline. InChIKey: HTVZQOWXJLNSFO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | N-ethyl-3-nitroaniline |
| InChIKey | HTVZQOWXJLNSFO-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)