CAS 431949-21-2 is the registry number for Alanyl Glutamine Impurity 34 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (CAS 431949-21-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: propan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate. InChIKey: RKCPKIKDCIZSSV-BQBZGAKWSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | propan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| InChIKey | RKCPKIKDCIZSSV-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC(C)C)N |
Computed by PubChem (NCBI)