Products 431949-21-2

CAS 431949-21-2 is the registry number for Alanyl Glutamine Impurity 34 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (CAS 431949-21-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: propan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate. InChIKey: RKCPKIKDCIZSSV-BQBZGAKWSA-N.

Identity
Molecular formulaC9H18N2O3
Molecular weight202.25 g/mol
IUPAC namepropan-2-yl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate
InChIKeyRKCPKIKDCIZSSV-BQBZGAKWSA-N
SMILESC[C@@H](C(=O)N[C@@H](C)C(=O)OC(C)C)N

Computed by PubChem (NCBI)