Products 432545-60-3
CAS 432545-60-3 appears in our catalog under these names: Methotrexate Impurity 23, Methotrexate-d3 Dimethyl Ester. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
Dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate (CAS 432545-60-3) is a chemical compound with the molecular formula C22H26N8O5 and a molecular weight of 485.5 g/mol. IUPAC name: dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate. InChIKey: DIQFVFAFHNQUTG-FIBGUPNXSA-N.
| Molecular formula | C22H26N8O5 |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | dimethyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-(trideuteriomethyl)amino]benzoyl]amino]pentanedioate |
| InChIKey | DIQFVFAFHNQUTG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methotrexate-methyl-d3, Dimethyl Ester