CAS 65148-64-3 is the registry number for Methotrexate Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-ethoxy-5-oxopentanoic acid (CAS 65148-64-3) is a chemical compound with the molecular formula C22H26N8O5 and a molecular weight of 482.5 g/mol. IUPAC name: (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-ethoxy-5-oxopentanoic acid. InChIKey: CYBKLZCFMQQPOM-HNNXBMFYSA-N.
| Molecular formula | C22H26N8O5 |
|---|---|
| Molecular weight | 482.5 g/mol |
| IUPAC name | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-ethoxy-5-oxopentanoic acid |
| InChIKey | CYBKLZCFMQQPOM-HNNXBMFYSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)NC(=O)C1=CC=C(C=C1)N(C)CC2=CN=C3C(=N2)C(=NC(=N3)N)N |
Computed by PubChem (NCBI)