Products 433219-55-7
CAS 433219-55-7 appears in our catalog under these names: (S)-Butaprost free acid, Butaprost (free acid), (S)-Butaprost (free acid). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 500ug, 500μg, 10 mg, 1 mg, 5 mg.
7-[(1R,2R,3R)-3-hydroxy-2-[(E,4S)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]heptanoic acid (CAS 433219-55-7) is a chemical compound with the molecular formula C23H38O5 and a molecular weight of 394.5 g/mol. IUPAC name: 7-[(1R,2R,3R)-3-hydroxy-2-[(E,4S)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]heptanoic acid. InChIKey: PAYNQYXOKJDXAV-ZHIWTBQHSA-N.
| Molecular formula | C23H38O5 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E,4S)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| InChIKey | PAYNQYXOKJDXAV-ZHIWTBQHSA-N |
| SMILES | CCCC1(CCC1)[C@H](C/C=C/[C@H]2[C@@H](CC(=O)[C@@H]2CCCCCCC(=O)O)O)O |
Computed by PubChem (NCBI)