CAS 71845-66-4 appears in our catalog under these names: Prostaglandin E2 isopropyl ester, Prostaglandin E2 isopropyl ester. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 1 mg, 5 mg.
Propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate (CAS 71845-66-4) is a chemical compound with the molecular formula C23H38O5 and a molecular weight of 394.5 g/mol. IUPAC name: propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate. InChIKey: NOHLKSJQMSPOTB-FZNVCOGTSA-N.
| Molecular formula | C23H38O5 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | propan-2-yl (Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
| InChIKey | NOHLKSJQMSPOTB-FZNVCOGTSA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C)O)O |
Computed by PubChem (NCBI)