CAS 433228-88-7 appears in our catalog under these names: Benzenemethanol, 3,5–difluoro–alpha–methyl–, (alphaR)– (9CI), (R)-1-(3,5-Difluorophenyl)ethanol, 95%, 95%, (R)-1-(3,5-Difluorophenyl)ethan-1-ol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(1R)-1-(3,5-difluorophenyl)ethanol (CAS 433228-88-7) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1R)-1-(3,5-difluorophenyl)ethanol. InChIKey: UEGDJZYKJPZJAA-RXMQYKEDSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1R)-1-(3,5-difluorophenyl)ethanol |
| InChIKey | UEGDJZYKJPZJAA-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)F)F)O |
Computed by PubChem (NCBI)