CAS 692732-03-9 appears in our catalog under these names: (S)–1–(3,5–Difluorophenyl)ethanol, (S)-1-(3,5-Difluorophenyl)ethanol, 98%, 98%, (S)-1-(3,5-Difluorophenyl)ethan-1-ol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(1S)-1-(3,5-difluorophenyl)ethanol (CAS 692732-03-9) is a chemical compound with the molecular formula C8H8F2O and a molecular weight of 158.14 g/mol. IUPAC name: (1S)-1-(3,5-difluorophenyl)ethanol. InChIKey: UEGDJZYKJPZJAA-YFKPBYRVSA-N.
| Molecular formula | C8H8F2O |
|---|---|
| Molecular weight | 158.14 g/mol |
| IUPAC name | (1S)-1-(3,5-difluorophenyl)ethanol |
| InChIKey | UEGDJZYKJPZJAA-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)F)F)O |
Computed by PubChem (NCBI)