Products 4337-66-0
CAS 4337-66-0 is the registry number for Ethanol, 2-amino-, benzoate (1:1), ≥98.0%, ≥98.0%. Offered by: Chemat. Available pack sizes: 500g.
2-hydroxyethylazanium benzoate (CAS 4337-66-0) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 2-hydroxyethylazanium benzoate. InChIKey: WUGCLPOLOCIDHW-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 2-hydroxyethylazanium benzoate |
| InChIKey | WUGCLPOLOCIDHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].C(CO)[NH3+] |
Computed by PubChem (NCBI)
Synonyms:
Ethanol, 2-amino-, benzoate (salt), Monoethanolamine benzoate, 2-hydroxyethylazanium;benzoate, benzoic acid, compound with 2-aminoethanol (1, Benzoic acid, ethanolamine salt, Benzenecarboxylic acid, ethanolamine salt, 2-hydroxyethylammonium benzoate, 2-Aminoethan-1-ol benzoate salt, 2-Hydroxyethan-1-aminium benzoate