Products 433954-52-0

CAS 433954-52-0 is the registry number for 3-(3-([1,1'-Biphenyl]-4-carbonyl)thioureido)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid (CAS 433954-52-0) is a chemical compound with the molecular formula C21H16N2O3S and a molecular weight of 376.4 g/mol. IUPAC name: 3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid. InChIKey: JQQOYHLMQIIFNE-UHFFFAOYSA-N.

Identity
Molecular formulaC21H16N2O3S
Molecular weight376.4 g/mol
IUPAC name3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid
InChIKeyJQQOYHLMQIIFNE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC(=S)NC3=CC=CC(=C3)C(=O)O

Computed by PubChem (NCBI)