CAS 433954-52-0 is the registry number for 3-(3-([1,1'-Biphenyl]-4-carbonyl)thioureido)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid (CAS 433954-52-0) is a chemical compound with the molecular formula C21H16N2O3S and a molecular weight of 376.4 g/mol. IUPAC name: 3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid. InChIKey: JQQOYHLMQIIFNE-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O3S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 3-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
| InChIKey | JQQOYHLMQIIFNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC(=S)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)