CAS 434957-15-0 is the registry number for 3,5-Bis(trifluoromethyl)phenyl(trifluoromethylsulfonyl)methane, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
1,3-bis(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene (CAS 434957-15-0) is a chemical compound with the molecular formula C10H5F9O2S and a molecular weight of 360.20 g/mol. IUPAC name: 1,3-bis(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene. InChIKey: VTBVTQYWSNXXNY-UHFFFAOYSA-N.
| Molecular formula | C10H5F9O2S |
|---|---|
| Molecular weight | 360.20 g/mol |
| IUPAC name | 1,3-bis(trifluoromethyl)-5-(trifluoromethylsulfonylmethyl)benzene |
| InChIKey | VTBVTQYWSNXXNY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)