CAS 68596-36-1 is the registry number for ((1,1,1,3,3,3-Hexafluoro-2-(trifluoromethyl)propan-2-yl)sulfonyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonylbenzene (CAS 68596-36-1) is a chemical compound with the molecular formula C10H5F9O2S and a molecular weight of 360.20 g/mol. IUPAC name: [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonylbenzene. InChIKey: DYPTXGRJNFHDIX-UHFFFAOYSA-N.
| Molecular formula | C10H5F9O2S |
|---|---|
| Molecular weight | 360.20 g/mol |
| IUPAC name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]sulfonylbenzene |
| InChIKey | DYPTXGRJNFHDIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)